C8H8N2 — CID 86330146
(5S)-5-methyl-5H-pyrrolo[2,3-b]pyridine (PubChem CID 86330146) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is (5S)-5-methyl-5H-pyrrolo[2,3-b]pyridine.
| Compound Name | (5S)-5-methyl-5H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 86330146 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | (5S)-5-methyl-5H-pyrrolo[2,3-b]pyridine |
| SMILES | C[C@@H]1C=NC2=NC=CC2=C1 |
| InChI | InChI=1S/C8H8N2/c1-6-4-7-2-3-9-8(7)10-5-6/h2-6H,1H3/t6-/m0/s1 |
| InChIKey | QXIOKSWAUSLRPS-LURJTMIESA-N |
| XLogP | 1.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |