C14H16BrN3 — CID 86334637
(3R)-14-bromo-1,7,11-triazatetracyclo[8.7.0.03,7.012,17]heptadeca-10,12(17),13,15-tetraene (PubChem CID 86334637) has the molecular formula C14H16BrN3 and a molecular weight of 306.21 g/mol. Its IUPAC name is (3R)-14-bromo-1,7,11-triazatetracyclo[8.7.0.03,7.012,17]heptadeca-10,12(17),13,15-tetraene.
| Compound Name | (3R)-14-bromo-1,7,11-triazatetracyclo[8.7.0.03,7.012,17]heptadeca-10,12(17),13,15-tetraene |
|---|---|
| PubChem CID | 86334637 |
| Molecular Formula | C14H16BrN3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (3R)-14-bromo-1,7,11-triazatetracyclo[8.7.0.03,7.012,17]heptadeca-10,12(17),13,15-tetraene |
| SMILES | Brc1ccc2c(c1)nc1n2C[C@H]2CCCN2CC1 |
| InChI | InChI=1S/C14H16BrN3/c15-10-3-4-13-12(8-10)16-14-5-7-17-6-1-2-11(17)9-18(13)14/h3-4,8,11H,1-2,5-7,9H2/t11-/m1/s1 |
| InChIKey | GMDAKTOTLYKIHT-LLVKDONJSA-N |
| XLogP | 2.82 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |