About 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine
8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine (PubChem CID 86340920) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine.
Analyze 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine?
The IUPAC name of 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine (CID 86340920) is 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine.
What is the SMILES notation for 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine?
The canonical SMILES for 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine is CC1=C2NCCNC2NC=C1.
What is the InChIKey of 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine?
The InChIKey is MHZLWPZLBYGMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6-2-3-10-8-7(6)9-4-5-11-8/h2-3,8-11H,4-5H2,1H3.
What are the key properties of 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine?
8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine has a molecular weight of 151.21 g/mol, XLogP of -0.10, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,2,3,4,4a,5-hexahydropyrido[2,3-b]pyrazine is sourced from PubChem (CID 86340920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).