About 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine
4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine (PubChem CID 86341229) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine |
| PubChem CID | 86341229 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine |
| SMILES | CC1=CC(NCC2CCNCC2)NC=C1 |
| InChI | InChI=1S/C12H21N3/c1-10-2-7-14-12(8-10)15-9-11-3-5-13-6-4-11/h2,7-8,11-15H,3-6,9H2,1H3 |
| InChIKey | GTLYJPYIEDAEDU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine?
The IUPAC name of 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine (CID 86341229) is 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine.
What is the SMILES notation for 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine?
The canonical SMILES for 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine is CC1=CC(NCC2CCNCC2)NC=C1.
What is the InChIKey of 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine?
The InChIKey is GTLYJPYIEDAEDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-10-2-7-14-12(8-10)15-9-11-3-5-13-6-4-11/h2,7-8,11-15H,3-6,9H2,1H3.
What are the key properties of 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine?
4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine has a molecular weight of 207.32 g/mol, XLogP of 0.96, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(piperidin-4-ylmethyl)-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 86341229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).