C10H9NO3 — CID 86346333
N-[4-(2,3-dioxopropyl)phenyl]formamide (PubChem CID 86346333) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is N-[4-(2,3-dioxopropyl)phenyl]formamide.
| Compound Name | N-[4-(2,3-dioxopropyl)phenyl]formamide |
|---|---|
| PubChem CID | 86346333 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | N-[4-(2,3-dioxopropyl)phenyl]formamide |
| SMILES | O=CNc1ccc(CC(=O)C=O)cc1 |
| InChI | InChI=1S/C10H9NO3/c12-6-10(14)5-8-1-3-9(4-2-8)11-7-13/h1-4,6-7H,5H2,(H,11,13) |
| InChIKey | HNZIUOPAYINHCT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|