C22H17ClN2O4 — CID 8639358
[(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-methylbenzo[g][1]benzofuran-2-carboxylate (PubChem CID 8639358) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-methylbenzo[g][1]benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-methylbenzo[g][1]benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8639358 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-methylbenzo[g][1]benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)O[C@@H](C)C(=O)Nc2cccnc2Cl)oc2c1ccc1ccccc12 |
| InChI | InChI=1S/C22H17ClN2O4/c1-12-15-10-9-14-6-3-4-7-16(14)19(15)29-18(12)22(27)28-13(2)21(26)25-17-8-5-11-24-20(17)23/h3-11,13H,1-2H3,(H,25,26)/t13-/m0/s1 |
| InChIKey | XYYFKDDAGMLTJL-ZDUSSCGKSA-N |
| XLogP | 5.13 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|