C14H14FN7O2S — CID 8639889
6-[[5-[(1R)-1-(4-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 8639889) has the molecular formula C14H14FN7O2S and a molecular weight of 363.38 g/mol. Its IUPAC name is 6-[[5-[(1R)-1-(4-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-[(1R)-1-(4-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 8639889 |
| Molecular Formula | C14H14FN7O2S |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 6-[[5-[(1R)-1-(4-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](Oc1ccc(F)cc1)c1nnc(SCc2nc(N)nc(N)n2)o1 |
| InChI | InChI=1S/C14H14FN7O2S/c1-7(23-9-4-2-8(15)3-5-9)11-21-22-14(24-11)25-6-10-18-12(16)20-13(17)19-10/h2-5,7H,6H2,1H3,(H4,16,17,18,19,20)/t7-/m1/s1 |
| InChIKey | PAWZVCYENAAJRB-SSDOTTSWSA-N |
| XLogP | 1.99 |
| TPSA | 138.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |