C17H15ClO4S — CID 8643140
(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8643140) has the molecular formula C17H15ClO4S and a molecular weight of 350.82 g/mol. Its IUPAC name is (6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | (6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8643140 |
| Molecular Formula | C17H15ClO4S |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | (6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1cccs1)OCc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H15ClO4S/c18-14-9-12(10-15-17(14)21-7-2-6-20-15)11-22-16(19)5-4-13-3-1-8-23-13/h1,3-5,8-10H,2,6-7,11H2/b5-4+ |
| InChIKey | PLJZJPCFSMPMEE-SNAWJCMRSA-N |
| XLogP | 4.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|