C17H15ClN2O6 — CID 18270597
(7-chloro-1,3-benzodioxol-5-yl)methyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate (PubChem CID 18270597) has the molecular formula C17H15ClN2O6 and a molecular weight of 378.77 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)methyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate.
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)methyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 18270597 |
| Molecular Formula | C17H15ClN2O6 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)methyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
| SMILES | Cn1cc(/C=C/C(=O)OCc2cc(Cl)c3c(c2)OCO3)c(=O)n(C)c1=O |
| InChI | InChI=1S/C17H15ClN2O6/c1-19-7-11(16(22)20(2)17(19)23)3-4-14(21)24-8-10-5-12(18)15-13(6-10)25-9-26-15/h3-7H,8-9H2,1-2H3/b4-3+ |
| InChIKey | AYCPFOYNJJSGLT-ONEGZZNKSA-N |
| XLogP | 1.22 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|