C17H24N2O4 — CID 75413597
cyclooctyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate (PubChem CID 75413597) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is cyclooctyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate.
| Compound Name | cyclooctyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 75413597 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | cyclooctyl (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
| SMILES | Cn1cc(/C=C/C(=O)OC2CCCCCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C17H24N2O4/c1-18-12-13(16(21)19(2)17(18)22)10-11-15(20)23-14-8-6-4-3-5-7-9-14/h10-12,14H,3-9H2,1-2H3/b11-10+ |
| InChIKey | LHBGLZCXVZFSEA-ZHACJKMWSA-N |
| XLogP | 1.75 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|