C20H25ClN2O3 — CID 8644871
(2R)-2-(5-chloro-2,4-dimethoxyanilino)-N,N-diethyl-2-phenylacetamide (PubChem CID 8644871) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is (2R)-2-(5-chloro-2,4-dimethoxyanilino)-N,N-diethyl-2-phenylacetamide.
| Compound Name | (2R)-2-(5-chloro-2,4-dimethoxyanilino)-N,N-diethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 8644871 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (2R)-2-(5-chloro-2,4-dimethoxyanilino)-N,N-diethyl-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)[C@H](Nc1cc(Cl)c(OC)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-5-23(6-2)20(24)19(14-10-8-7-9-11-14)22-16-12-15(21)17(25-3)13-18(16)26-4/h7-13,19,22H,5-6H2,1-4H3/t19-/m1/s1 |
| InChIKey | QBCPASBOQWLOIL-LJQANCHMSA-N |
| XLogP | 4.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|