C17H15N3O6S — CID 8648371
N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-[(2-nitro-3-pyridinyl)oxy]-N-phenylacetamide (PubChem CID 8648371) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-[(2-nitro-3-pyridinyl)oxy]-N-phenylacetamide.
| Compound Name | N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-[(2-nitro-3-pyridinyl)oxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 8648371 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-[(2-nitro-3-pyridinyl)oxy]-N-phenylacetamide |
| SMILES | O=C(COc1cccnc1[N+](=O)[O-])N(c1ccccc1)[C@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C17H15N3O6S/c21-16(11-26-15-7-4-9-18-17(15)20(22)23)19(13-5-2-1-3-6-13)14-8-10-27(24,25)12-14/h1-10,14H,11-12H2/t14-/m0/s1 |
| InChIKey | VXKRNJFYJNKGJV-AWEZNQCLSA-N |
| XLogP | 1.71 |
| TPSA | 119.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|