C19H22F2N4O2S — CID 8654187
1-[4-(difluoromethoxy)phenyl]-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]thiourea (PubChem CID 8654187) has the molecular formula C19H22F2N4O2S and a molecular weight of 408.47 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8654187 |
| Molecular Formula | C19H22F2N4O2S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]thiourea |
| SMILES | Cc1cc(C)c(NCC(=O)NNC(=S)Nc2ccc(OC(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C19H22F2N4O2S/c1-11-8-12(2)17(13(3)9-11)22-10-16(26)24-25-19(28)23-14-4-6-15(7-5-14)27-18(20)21/h4-9,18,22H,10H2,1-3H3,(H,24,26)(H2,23,25,28) |
| InChIKey | HVTSAYWZFNOOQI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|