C13H18N4S — CID 865608
3-[(2,4-dimethylanilino)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 865608) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 3-[(2,4-dimethylanilino)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2,4-dimethylanilino)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 865608 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[(2,4-dimethylanilino)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(CNc2ccc(C)cc2C)n[nH]c1=S |
| InChI | InChI=1S/C13H18N4S/c1-4-17-12(15-16-13(17)18)8-14-11-6-5-9(2)7-10(11)3/h5-7,14H,4,8H2,1-3H3,(H,16,18) |
| InChIKey | MZTXCLWKIODTJB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|