C17H9Cl3N4O2 — CID 86566431
2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]acetonitrile (PubChem CID 86566431) has the molecular formula C17H9Cl3N4O2 and a molecular weight of 411.67 g/mol. Its IUPAC name is 2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]acetonitrile.
| Compound Name | 2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 86566431 |
| Molecular Formula | C17H9Cl3N4O2 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]acetonitrile |
| SMILES | [2H]c1c([2H])c(C(C#N)c2c(Cl)cc(-n3ncc(=O)[nH]c3=O)cc2Cl)c([2H])c([2H])c1Cl |
| InChI | InChI=1S/C17H9Cl3N4O2/c18-10-3-1-9(2-4-10)12(7-21)16-13(19)5-11(6-14(16)20)24-17(26)23-15(25)8-22-24/h1-6,8,12H,(H,23,25,26)/i1D,2D,3D,4D |
| InChIKey | ZSZFUDFOPOMEET-RHQRLBAQSA-N |
| XLogP | 3.54 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |