C20H14N6 — CID 86566652
6-[(5-pyridin-4-ylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline (PubChem CID 86566652) has the molecular formula C20H14N6 and a molecular weight of 338.37 g/mol. Its IUPAC name is 6-[(5-pyridin-4-ylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline.
| Compound Name | 6-[(5-pyridin-4-ylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline |
|---|---|
| PubChem CID | 86566652 |
| Molecular Formula | C20H14N6 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 6-[(5-pyridin-4-ylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline |
| SMILES | c1cnc2ccc(Cn3cnc4ncc(-c5ccncc5)nc43)cc2c1 |
| InChI | InChI=1S/C20H14N6/c1-2-16-10-14(3-4-17(16)22-7-1)12-26-13-24-19-20(26)25-18(11-23-19)15-5-8-21-9-6-15/h1-11,13H,12H2 |
| InChIKey | SLHQNGXPNSTZIZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |