C24H43NO2 — CID 86573562
(2E,4E,14Z)-6-hydroxy-N-(2-methylpropyl)icosa-2,4,14-trienamide (PubChem CID 86573562) has the molecular formula C24H43NO2 and a molecular weight of 377.61 g/mol. Its IUPAC name is (2E,4E,14Z)-6-hydroxy-N-(2-methylpropyl)icosa-2,4,14-trienamide.
| Compound Name | (2E,4E,14Z)-6-hydroxy-N-(2-methylpropyl)icosa-2,4,14-trienamide |
|---|---|
| PubChem CID | 86573562 |
| Molecular Formula | C24H43NO2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 377.33 |
| IUPAC Name | (2E,4E,14Z)-6-hydroxy-N-(2-methylpropyl)icosa-2,4,14-trienamide |
| SMILES | CCCCC/C=C\CCCCCCCC(O)/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C24H43NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-18-23(26)19-16-17-20-24(27)25-21-22(2)3/h8-9,16-17,19-20,22-23,26H,4-7,10-15,18,21H2,1-3H3,(H,25,27)/b9-8-,19-16+,20-17+ |
| InChIKey | QMKLFORNOMOASV-OBVGHXCDSA-N |
| XLogP | 6.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|