C27H37NO4 — CID 139587895
(10R,12R,14R,26S)-10,12,14-trihydroxy-19,26-dimethyl-1-azacyclohexacosa-3,5,7,15,17,19,21,23-octaen-2-one (PubChem CID 139587895) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is (10R,12R,14R,26S)-10,12,14-trihydroxy-19,26-dimethyl-1-azacyclohexacosa-3,5,7,15,17,19,21,23-octaen-2-one.
| Compound Name | (10R,12R,14R,26S)-10,12,14-trihydroxy-19,26-dimethyl-1-azacyclohexacosa-3,5,7,15,17,19,21,23-octaen-2-one |
|---|---|
| PubChem CID | 139587895 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | (10R,12R,14R,26S)-10,12,14-trihydroxy-19,26-dimethyl-1-azacyclohexacosa-3,5,7,15,17,19,21,23-octaen-2-one |
| SMILES | CC1=CC=CC=CC[C@H](C)NC(=O)C=CC=CC=CC[C@@H](O)C[C@@H](O)C[C@@H](O)C=CC=C1 |
| InChI | InChI=1S/C27H37NO4/c1-22-14-8-6-7-9-16-23(2)28-27(32)19-11-5-3-4-10-17-24(29)20-26(31)21-25(30)18-13-12-15-22/h3-15,18-19,23-26,29-31H,16-17,20-21H2,1-2H3,(H,28,32)/t23-,24+,25-,26+/m0/s1 |
| InChIKey | UGEFTPDLHPVPKD-ROXDYWFKSA-N |
| XLogP | 3.99 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |