C29H39NO2 — CID 177451732
(3E,5E,7E,10R,11E,13E,15E,17Z)-10-hydroxy-7,15-dimethyl-20-[(2E,4E)-octa-2,4-dienyl]-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one (PubChem CID 177451732) has the molecular formula C29H39NO2 and a molecular weight of 433.64 g/mol. Its IUPAC name is (3E,5E,7E,10R,11E,13E,15E,17Z)-10-hydroxy-7,15-dimethyl-20-[(2E,4E)-octa-2,4-dienyl]-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one.
| Compound Name | (3E,5E,7E,10R,11E,13E,15E,17Z)-10-hydroxy-7,15-dimethyl-20-[(2E,4E)-octa-2,4-dienyl]-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one |
|---|---|
| PubChem CID | 177451732 |
| Molecular Formula | C29H39NO2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | (3E,5E,7E,10R,11E,13E,15E,17Z)-10-hydroxy-7,15-dimethyl-20-[(2E,4E)-octa-2,4-dienyl]-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one |
| SMILES | CCC/C=C/C=C/CC1C/C=C\C=C(C)\C=C\C=C\[C@H](O)C/C=C(C)/C=C/C=C/C(=O)N1 |
| InChI | InChI=1S/C29H39NO2/c1-4-5-6-7-8-9-19-27-20-13-10-16-25(2)17-11-14-21-28(31)24-23-26(3)18-12-15-22-29(32)30-27/h6-18,21-23,27-28,31H,4-5,19-20,24H2,1-3H3,(H,30,32)/b7-6+,9-8+,13-10-,17-11+,18-12+,21-14+,22-15+,25-16+,26-23+/t27?,28-/m0/s1 |
| InChIKey | QCDLQCCTHSWPBS-QAEAOKCFSA-N |
| XLogP | 6.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|