C30H46O5 — CID 86574983
(4aR,5R,6aR,6bR,7S,10S,12aS)-5,7,10-trihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid (PubChem CID 86574983) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is (4aR,5R,6aR,6bR,7S,10S,12aS)-5,7,10-trihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid.
| Compound Name | (4aR,5R,6aR,6bR,7S,10S,12aS)-5,7,10-trihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 86574983 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (4aR,5R,6aR,6bR,7S,10S,12aS)-5,7,10-trihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)CC[C@@]2(C(=O)O)C(=C3C=CC4[C@@]5(C)CC[C@H](O)C(C)(C)C5C[C@H](O)[C@@]4(C)[C@]3(C)C[C@H]2O)C1 |
| InChI | InChI=1S/C30H46O5/c1-25(2)12-13-30(24(34)35)18(15-25)17-8-9-19-27(5)11-10-21(31)26(3,4)20(27)14-22(32)29(19,7)28(17,6)16-23(30)33/h8-9,19-23,31-33H,10-16H2,1-7H3,(H,34,35)/t19?,20?,21-,22-,23+,27+,28+,29-,30+/m0/s1 |
| InChIKey | FSQOZKKQQFCBJB-LEDCUJGISA-N |
| XLogP | 5.10 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |