C14H20N2O16P2-2 — CID 86575030
[(2R,3R,4R,5S)-3,4-dihydroxy-5-(2-hydroxyethyl)oxolan-2-yl] [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]oxy-oxidophosphoryl] phosphate (PubChem CID 86575030) has the molecular formula C14H20N2O16P2-2 and a molecular weight of 534.26 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-dihydroxy-5-(2-hydroxyethyl)oxolan-2-yl] [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [(2R,3R,4R,5S)-3,4-dihydroxy-5-(2-hydroxyethyl)oxolan-2-yl] [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 86575030 |
| Molecular Formula | C14H20N2O16P2-2 |
| Molecular Weight | 534.26 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-dihydroxy-5-(2-hydroxyethyl)oxolan-2-yl] [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]oxy-oxidophosphoryl] phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](OP(=O)([O-])OP(=O)([O-])O[C@H]3O[C@@H](CCO)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C14H22N2O16P2/c17-4-2-5-7(19)9(21)12(28-5)30-33(24,25)32-34(26,27)31-13-10(22)8(20)11(29-13)16-3-1-6(18)15-14(16)23/h1,3,5,7-13,17,19-22H,2,4H2,(H,24,25)(H,26,27)(H,15,18,23)/p-2/t5-,7-,8+,9+,10-,11+,12+,13+/m0/s1 |
| InChIKey | CHMKSKGNMFJMCI-GOPMVAIXSA-L |
| XLogP | -5.07 |
| TPSA | 282.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.26 |
| LogP ≤ 5 | -5.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|