C12H12N4O — CID 86575799
1-amino-5-ethyl-3H-pyridazino[4,5-b]indol-4-one (PubChem CID 86575799) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-amino-5-ethyl-3H-pyridazino[4,5-b]indol-4-one.
| Compound Name | 1-amino-5-ethyl-3H-pyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 86575799 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-amino-5-ethyl-3H-pyridazino[4,5-b]indol-4-one |
| SMILES | CCn1c2ccccc2c2c(N)n[nH]c(=O)c21 |
| InChI | InChI=1S/C12H12N4O/c1-2-16-8-6-4-3-5-7(8)9-10(16)12(17)15-14-11(9)13/h3-6H,2H2,1H3,(H2,13,14)(H,15,17) |
| InChIKey | SJOUEALCPAYROX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |