C11H9N5O — CID 10105141
4,5-diamino-2H-pyridazino[4,5-c]quinolin-1-one (PubChem CID 10105141) has the molecular formula C11H9N5O and a molecular weight of 227.23 g/mol. Its IUPAC name is 4,5-diamino-2H-pyridazino[4,5-c]quinolin-1-one.
| Compound Name | 4,5-diamino-2H-pyridazino[4,5-c]quinolin-1-one |
|---|---|
| PubChem CID | 10105141 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 4,5-diamino-2H-pyridazino[4,5-c]quinolin-1-one |
| SMILES | Nc1n[nH]c(=O)c2c1c(N)nc1ccccc12 |
| InChI | InChI=1S/C11H9N5O/c12-9-8-7(11(17)16-15-10(8)13)5-3-1-2-4-6(5)14-9/h1-4H,(H2,12,14)(H2,13,15)(H,16,17) |
| InChIKey | FQINDVCXCSPQRK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|