C15H20N4 — CID 143094152
ethane;1-propyl-2H-pyrazolo[3,4-c]quinolin-4-amine (PubChem CID 143094152) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is ethane;1-propyl-2H-pyrazolo[3,4-c]quinolin-4-amine.
| Compound Name | ethane;1-propyl-2H-pyrazolo[3,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 143094152 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | ethane;1-propyl-2H-pyrazolo[3,4-c]quinolin-4-amine |
| SMILES | CC.CCCc1[nH]nc2c(N)nc3ccccc3c12 |
| InChI | InChI=1S/C13H14N4.C2H6/c1-2-5-10-11-8-6-3-4-7-9(8)15-13(14)12(11)17-16-10;1-2/h3-4,6-7H,2,5H2,1H3,(H2,14,15)(H,16,17);1-2H3 |
| InChIKey | UXAIREQSAMPZNC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |