C17H19N3O — CID 123892327
4-(5-aminobenzo[f][1,7]naphthyridin-1-yl)-2-methylbutan-2-ol (PubChem CID 123892327) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-(5-aminobenzo[f][1,7]naphthyridin-1-yl)-2-methylbutan-2-ol.
| Compound Name | 4-(5-aminobenzo[f][1,7]naphthyridin-1-yl)-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 123892327 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 4-(5-aminobenzo[f][1,7]naphthyridin-1-yl)-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCc1ccnc2c(N)nc3ccccc3c12 |
| InChI | InChI=1S/C17H19N3O/c1-17(2,21)9-7-11-8-10-19-15-14(11)12-5-3-4-6-13(12)20-16(15)18/h3-6,8,10,21H,7,9H2,1-2H3,(H2,18,20) |
| InChIKey | COEIINMTAGOVID-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|