C15H13BrN2O2S — CID 86579946
5-[(1,3-benzothiazol-6-ylamino)methyl]-2-bromo-3-methoxyphenol (PubChem CID 86579946) has the molecular formula C15H13BrN2O2S and a molecular weight of 365.25 g/mol. Its IUPAC name is 5-[(1,3-benzothiazol-6-ylamino)methyl]-2-bromo-3-methoxyphenol.
| Compound Name | 5-[(1,3-benzothiazol-6-ylamino)methyl]-2-bromo-3-methoxyphenol |
|---|---|
| PubChem CID | 86579946 |
| Molecular Formula | C15H13BrN2O2S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 5-[(1,3-benzothiazol-6-ylamino)methyl]-2-bromo-3-methoxyphenol |
| SMILES | COc1cc(CNc2ccc3ncsc3c2)cc(O)c1Br |
| InChI | InChI=1S/C15H13BrN2O2S/c1-20-13-5-9(4-12(19)15(13)16)7-17-10-2-3-11-14(6-10)21-8-18-11/h2-6,8,17,19H,7H2,1H3 |
| InChIKey | DIRSXCIPDXJFJD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |