C22H25N4O4P — CID 86580090
N-[4-[[ethoxy(propyl)phosphoryl]methyl]phenyl]-6-(3-nitrophenyl)pyrimidin-4-amine (PubChem CID 86580090) has the molecular formula C22H25N4O4P and a molecular weight of 440.44 g/mol. Its IUPAC name is N-[4-[[ethoxy(propyl)phosphoryl]methyl]phenyl]-6-(3-nitrophenyl)pyrimidin-4-amine.
| Compound Name | N-[4-[[ethoxy(propyl)phosphoryl]methyl]phenyl]-6-(3-nitrophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 86580090 |
| Molecular Formula | C22H25N4O4P |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[4-[[ethoxy(propyl)phosphoryl]methyl]phenyl]-6-(3-nitrophenyl)pyrimidin-4-amine |
| SMILES | CCCP(=O)(Cc1ccc(Nc2cc(-c3cccc([N+](=O)[O-])c3)ncn2)cc1)OCC |
| InChI | InChI=1S/C22H25N4O4P/c1-3-12-31(29,30-4-2)15-17-8-10-19(11-9-17)25-22-14-21(23-16-24-22)18-6-5-7-20(13-18)26(27)28/h5-11,13-14,16H,3-4,12,15H2,1-2H3,(H,23,24,25) |
| InChIKey | JZVPTAZYTCXRSM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|