C24H23N4P — CID 59035129
4-N-ethyl-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]-4-N-tritiophosphanylbenzene-1,4-diamine (PubChem CID 59035129) has the molecular formula C24H23N4P and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-N-ethyl-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]-4-N-tritiophosphanylbenzene-1,4-diamine.
| Compound Name | 4-N-ethyl-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]-4-N-tritiophosphanylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 59035129 |
| Molecular Formula | C24H23N4P |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-N-ethyl-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]-4-N-tritiophosphanylbenzene-1,4-diamine |
| SMILES | [3H]PN(CC)c1ccc(Nc2cc(-c3cccc(-c4ccccc4)c3)ncn2)cc1 |
| InChI | InChI=1S/C24H23N4P/c1-2-28(29)22-13-11-21(12-14-22)27-24-16-23(25-17-26-24)20-10-6-9-19(15-20)18-7-4-3-5-8-18/h3-17H,2,29H2,1H3,(H,25,26,27)/i29T |
| InChIKey | CUKCIZPYDDNHGZ-FZOYFJBJSA-N |
| XLogP | 6.17 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|