C30H37ClN4 — CID 91171853
4-N-(2-chloroethyl)-4-N-ethyl-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]benzene-1,4-diamine;ethane (PubChem CID 91171853) has the molecular formula C30H37ClN4 and a molecular weight of 489.11 g/mol. Its IUPAC name is 4-N-(2-chloroethyl)-4-N-ethyl-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]benzene-1,4-diamine;ethane.
| Compound Name | 4-N-(2-chloroethyl)-4-N-ethyl-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]benzene-1,4-diamine;ethane |
|---|---|
| PubChem CID | 91171853 |
| Molecular Formula | C30H37ClN4 |
| Molecular Weight | 489.11 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 4-N-(2-chloroethyl)-4-N-ethyl-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]benzene-1,4-diamine;ethane |
| SMILES | CC.CC.CCN(CCCl)c1ccc(Nc2cc(-c3cccc(-c4ccccc4)c3)ncn2)cc1 |
| InChI | InChI=1S/C26H25ClN4.2C2H6/c1-2-31(16-15-27)24-13-11-23(12-14-24)30-26-18-25(28-19-29-26)22-10-6-9-21(17-22)20-7-4-3-5-8-20;2*1-2/h3-14,17-19H,2,15-16H2,1H3,(H,28,29,30);2*1-2H3 |
| InChIKey | DQPPKMZBNVOOIE-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.11 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|