C34H39N5O2 — CID 59035110
N-[2-[4-[butanoyl-[6-(3-phenylphenyl)pyrimidin-4-yl]amino]-N-ethylanilino]ethyl]butanamide (PubChem CID 59035110) has the molecular formula C34H39N5O2 and a molecular weight of 549.72 g/mol. Its IUPAC name is N-[2-[4-[butanoyl-[6-(3-phenylphenyl)pyrimidin-4-yl]amino]-N-ethylanilino]ethyl]butanamide.
| Compound Name | N-[2-[4-[butanoyl-[6-(3-phenylphenyl)pyrimidin-4-yl]amino]-N-ethylanilino]ethyl]butanamide |
|---|---|
| PubChem CID | 59035110 |
| Molecular Formula | C34H39N5O2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | N-[2-[4-[butanoyl-[6-(3-phenylphenyl)pyrimidin-4-yl]amino]-N-ethylanilino]ethyl]butanamide |
| SMILES | CCCC(=O)NCCN(CC)c1ccc(N(C(=O)CCC)c2cc(-c3cccc(-c4ccccc4)c3)ncn2)cc1 |
| InChI | InChI=1S/C34H39N5O2/c1-4-11-33(40)35-21-22-38(6-3)29-17-19-30(20-18-29)39(34(41)12-5-2)32-24-31(36-25-37-32)28-16-10-15-27(23-28)26-13-8-7-9-14-26/h7-10,13-20,23-25H,4-6,11-12,21-22H2,1-3H3,(H,35,40) |
| InChIKey | INRDDHAXRMKVGU-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|