C32H38N6O — CID 11398317
4-N-ethyl-4-N-[2-(2-morpholin-4-ylethylamino)ethyl]-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]benzene-1,4-diamine (PubChem CID 11398317) has the molecular formula C32H38N6O and a molecular weight of 522.70 g/mol. Its IUPAC name is 4-N-ethyl-4-N-[2-(2-morpholin-4-ylethylamino)ethyl]-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-ethyl-4-N-[2-(2-morpholin-4-ylethylamino)ethyl]-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 11398317 |
| Molecular Formula | C32H38N6O |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | 4-N-ethyl-4-N-[2-(2-morpholin-4-ylethylamino)ethyl]-1-N-[6-(3-phenylphenyl)pyrimidin-4-yl]benzene-1,4-diamine |
| SMILES | CCN(CCNCCN1CCOCC1)c1ccc(Nc2cc(-c3cccc(-c4ccccc4)c3)ncn2)cc1 |
| InChI | InChI=1S/C32H38N6O/c1-2-38(18-16-33-15-17-37-19-21-39-22-20-37)30-13-11-29(12-14-30)36-32-24-31(34-25-35-32)28-10-6-9-27(23-28)26-7-4-3-5-8-26/h3-14,23-25,33H,2,15-22H2,1H3,(H,34,35,36) |
| InChIKey | VMBLQTOTGXVBAH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|