C32H39N3O2 — CID 86582279
4-[3-[4-[2-(dimethylamino)ethoxy-diphenylmethyl]piperidin-1-yl]propoxy]benzonitrile (PubChem CID 86582279) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is 4-[3-[4-[2-(dimethylamino)ethoxy-diphenylmethyl]piperidin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[4-[2-(dimethylamino)ethoxy-diphenylmethyl]piperidin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 86582279 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 4-[3-[4-[2-(dimethylamino)ethoxy-diphenylmethyl]piperidin-1-yl]propoxy]benzonitrile |
| SMILES | CN(C)CCOC(c1ccccc1)(c1ccccc1)C1CCN(CCCOc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C32H39N3O2/c1-34(2)23-25-37-32(28-10-5-3-6-11-28,29-12-7-4-8-13-29)30-18-21-35(22-19-30)20-9-24-36-31-16-14-27(26-33)15-17-31/h3-8,10-17,30H,9,18-25H2,1-2H3 |
| InChIKey | BTWMMWONZGPRGU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|