C23H30O7 — CID 86584077
(1-ethylcyclopentyl) 3-acetyloxy-3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate;furan-2,5-dione (PubChem CID 86584077) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 3-acetyloxy-3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate;furan-2,5-dione.
| Compound Name | (1-ethylcyclopentyl) 3-acetyloxy-3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate;furan-2,5-dione |
|---|---|
| PubChem CID | 86584077 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (1-ethylcyclopentyl) 3-acetyloxy-3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate;furan-2,5-dione |
| SMILES | CCC1(OC(=O)CC(OC(C)=O)C2CC3C=CC2C3)CCCC1.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C19H28O4.C4H2O3/c1-3-19(8-4-5-9-19)23-18(21)12-17(22-13(2)20)16-11-14-6-7-15(16)10-14;5-3-1-2-4(6)7-3/h6-7,14-17H,3-5,8-12H2,1-2H3;1-2H |
| InChIKey | KCRXPDAAJOZDGI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|