C20H25NO5S2 — CID 86584193
2-[4-(2-piperidin-1-ylethoxy)phenyl]-2-thiophen-2-ylsulfonylpropanoic acid (PubChem CID 86584193) has the molecular formula C20H25NO5S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-[4-(2-piperidin-1-ylethoxy)phenyl]-2-thiophen-2-ylsulfonylpropanoic acid.
| Compound Name | 2-[4-(2-piperidin-1-ylethoxy)phenyl]-2-thiophen-2-ylsulfonylpropanoic acid |
|---|---|
| PubChem CID | 86584193 |
| Molecular Formula | C20H25NO5S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-[4-(2-piperidin-1-ylethoxy)phenyl]-2-thiophen-2-ylsulfonylpropanoic acid |
| SMILES | CC(C(=O)O)(c1ccc(OCCN2CCCCC2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H25NO5S2/c1-20(19(22)23,28(24,25)18-6-5-15-27-18)16-7-9-17(10-8-16)26-14-13-21-11-3-2-4-12-21/h5-10,15H,2-4,11-14H2,1H3,(H,22,23) |
| InChIKey | PGFYFMZTQOQIQB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |