C6H13NO3S2 — CID 86584851
[(2S,4R)-1-methylsulfonyl-4-sulfanylpyrrolidin-2-yl]methanol (PubChem CID 86584851) has the molecular formula C6H13NO3S2 and a molecular weight of 211.31 g/mol. Its IUPAC name is [(2S,4R)-1-methylsulfonyl-4-sulfanylpyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4R)-1-methylsulfonyl-4-sulfanylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 86584851 |
| Molecular Formula | C6H13NO3S2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | [(2S,4R)-1-methylsulfonyl-4-sulfanylpyrrolidin-2-yl]methanol |
| SMILES | CS(=O)(=O)N1C[C@H](S)C[C@H]1CO |
| InChI | InChI=1S/C6H13NO3S2/c1-12(9,10)7-3-6(11)2-5(7)4-8/h5-6,8,11H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | DPPHBCAKKBOOQM-NTSWFWBYSA-N |
| XLogP | -0.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|