C6H13N2O5S2+ — CID 102012417
[1,3-bis(methylsulfonyl)-4,5-dihydroimidazol-1-ium-4-yl]methanol (PubChem CID 102012417) has the molecular formula C6H13N2O5S2+ and a molecular weight of 257.31 g/mol. Its IUPAC name is [1,3-bis(methylsulfonyl)-4,5-dihydroimidazol-1-ium-4-yl]methanol.
| Compound Name | [1,3-bis(methylsulfonyl)-4,5-dihydroimidazol-1-ium-4-yl]methanol |
|---|---|
| PubChem CID | 102012417 |
| Molecular Formula | C6H13N2O5S2+ |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | [1,3-bis(methylsulfonyl)-4,5-dihydroimidazol-1-ium-4-yl]methanol |
| SMILES | CS(=O)(=O)N1C=[N+](S(C)(=O)=O)CC1CO |
| InChI | InChI=1S/C6H13N2O5S2/c1-14(10,11)7-3-6(4-9)8(5-7)15(2,12)13/h5-6,9H,3-4H2,1-2H3/q+1 |
| InChIKey | PLEYEGFRNHULHZ-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|