C33H46N2O8 — CID 86585529
tert-butyl 4-(2,3-dimethoxybenzoyl)piperidine-1-carboxylate;4-(2,3-dimethoxyphenyl)piperidine-4-carbaldehyde (PubChem CID 86585529) has the molecular formula C33H46N2O8 and a molecular weight of 598.74 g/mol. Its IUPAC name is tert-butyl 4-(2,3-dimethoxybenzoyl)piperidine-1-carboxylate;4-(2,3-dimethoxyphenyl)piperidine-4-carbaldehyde.
| Compound Name | tert-butyl 4-(2,3-dimethoxybenzoyl)piperidine-1-carboxylate;4-(2,3-dimethoxyphenyl)piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 86585529 |
| Molecular Formula | C33H46N2O8 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | tert-butyl 4-(2,3-dimethoxybenzoyl)piperidine-1-carboxylate;4-(2,3-dimethoxyphenyl)piperidine-4-carbaldehyde |
| SMILES | COc1cccc(C(=O)C2CCN(C(=O)OC(C)(C)C)CC2)c1OC.COc1cccc(C2(C=O)CCNCC2)c1OC |
| InChI | InChI=1S/C19H27NO5.C14H19NO3/c1-19(2,3)25-18(22)20-11-9-13(10-12-20)16(21)14-7-6-8-15(23-4)17(14)24-5;1-17-12-5-3-4-11(13(12)18-2)14(10-16)6-8-15-9-7-14/h6-8,13H,9-12H2,1-5H3;3-5,10,15H,6-9H2,1-2H3 |
| InChIKey | TYCGAXUYSAWMNB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|