C16H16N4O3S — CID 86589018
methyl N-[4-methoxy-7-(pyridin-2-ylmethylamino)-1,3-benzothiazol-2-yl]carbamate (PubChem CID 86589018) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is methyl N-[4-methoxy-7-(pyridin-2-ylmethylamino)-1,3-benzothiazol-2-yl]carbamate.
| Compound Name | methyl N-[4-methoxy-7-(pyridin-2-ylmethylamino)-1,3-benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 86589018 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | methyl N-[4-methoxy-7-(pyridin-2-ylmethylamino)-1,3-benzothiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2c(OC)ccc(NCc3ccccn3)c2s1 |
| InChI | InChI=1S/C16H16N4O3S/c1-22-12-7-6-11(18-9-10-5-3-4-8-17-10)14-13(12)19-15(24-14)20-16(21)23-2/h3-8,18H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | FAPYUQOSQYPHBH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|