C13H15BrN2O4S — CID 86584928
methyl N-[7-(2-bromo-1-hydroxypropyl)-4-methoxy-1,3-benzothiazol-2-yl]carbamate (PubChem CID 86584928) has the molecular formula C13H15BrN2O4S and a molecular weight of 375.24 g/mol. Its IUPAC name is methyl N-[7-(2-bromo-1-hydroxypropyl)-4-methoxy-1,3-benzothiazol-2-yl]carbamate.
| Compound Name | methyl N-[7-(2-bromo-1-hydroxypropyl)-4-methoxy-1,3-benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 86584928 |
| Molecular Formula | C13H15BrN2O4S |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | methyl N-[7-(2-bromo-1-hydroxypropyl)-4-methoxy-1,3-benzothiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2c(OC)ccc(C(O)C(C)Br)c2s1 |
| InChI | InChI=1S/C13H15BrN2O4S/c1-6(14)10(17)7-4-5-8(19-2)9-11(7)21-12(15-9)16-13(18)20-3/h4-6,10,17H,1-3H3,(H,15,16,18) |
| InChIKey | AWBZWEMQMDNDNG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|