C15H17BrN2O3S — CID 22970766
methyl N-[7-(2-bromopropanoyl)-4,5,6-trimethyl-1,3-benzothiazol-2-yl]carbamate (PubChem CID 22970766) has the molecular formula C15H17BrN2O3S and a molecular weight of 385.28 g/mol. Its IUPAC name is methyl N-[7-(2-bromopropanoyl)-4,5,6-trimethyl-1,3-benzothiazol-2-yl]carbamate.
| Compound Name | methyl N-[7-(2-bromopropanoyl)-4,5,6-trimethyl-1,3-benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 22970766 |
| Molecular Formula | C15H17BrN2O3S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | methyl N-[7-(2-bromopropanoyl)-4,5,6-trimethyl-1,3-benzothiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2c(C)c(C)c(C)c(C(=O)C(C)Br)c2s1 |
| InChI | InChI=1S/C15H17BrN2O3S/c1-6-7(2)10(12(19)9(4)16)13-11(8(6)3)17-14(22-13)18-15(20)21-5/h9H,1-5H3,(H,17,18,20) |
| InChIKey | FUSJOLNZAMCXEE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|