C38H37ClN2O4 — CID 86590787
4-(3-chlorophenyl)-2,6-dimethyl-5-[3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propoxycarbonyl]-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 86590787) has the molecular formula C38H37ClN2O4 and a molecular weight of 621.18 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2,6-dimethyl-5-[3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propoxycarbonyl]-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 4-(3-chlorophenyl)-2,6-dimethyl-5-[3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propoxycarbonyl]-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 86590787 |
| Molecular Formula | C38H37ClN2O4 |
| Molecular Weight | 621.18 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | 4-(3-chlorophenyl)-2,6-dimethyl-5-[3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propoxycarbonyl]-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc(Cl)c2)C(C(=O)OCCCN2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)=C(C)N1 |
| InChI | InChI=1S/C38H37ClN2O4/c1-24-33(37(42)43)36(29-11-7-12-30(39)23-29)34(25(2)40-24)38(44)45-22-8-19-41-20-17-28(18-21-41)35-31-13-5-3-9-26(31)15-16-27-10-4-6-14-32(27)35/h3-7,9-16,23,36,40H,8,17-22H2,1-2H3,(H,42,43) |
| InChIKey | PXTMYVYDZMNERJ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.18 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|