C29H28O2 — CID 86592393
3-[3-(1-adamantyl)-4-hydroxyphenyl]-5-phenylbenzaldehyde (PubChem CID 86592393) has the molecular formula C29H28O2 and a molecular weight of 408.54 g/mol. Its IUPAC name is 3-[3-(1-adamantyl)-4-hydroxyphenyl]-5-phenylbenzaldehyde.
| Compound Name | 3-[3-(1-adamantyl)-4-hydroxyphenyl]-5-phenylbenzaldehyde |
|---|---|
| PubChem CID | 86592393 |
| Molecular Formula | C29H28O2 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 3-[3-(1-adamantyl)-4-hydroxyphenyl]-5-phenylbenzaldehyde |
| SMILES | O=Cc1cc(-c2ccccc2)cc(-c2ccc(O)c(C34CC5CC(CC(C5)C3)C4)c2)c1 |
| InChI | InChI=1S/C29H28O2/c30-18-22-11-25(23-4-2-1-3-5-23)13-26(12-22)24-6-7-28(31)27(14-24)29-15-19-8-20(16-29)10-21(9-19)17-29/h1-7,11-14,18-21,31H,8-10,15-17H2 |
| InChIKey | CMWQHNBQUYIWBI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|