C31H31N3O4S — CID 86594005
tert-butyl N-[1-(4-methylphenyl)sulfonyl-6,6-diphenyl-7H-indazol-3-yl]carbamate (PubChem CID 86594005) has the molecular formula C31H31N3O4S and a molecular weight of 541.67 g/mol. Its IUPAC name is tert-butyl N-[1-(4-methylphenyl)sulfonyl-6,6-diphenyl-7H-indazol-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-methylphenyl)sulfonyl-6,6-diphenyl-7H-indazol-3-yl]carbamate |
|---|---|
| PubChem CID | 86594005 |
| Molecular Formula | C31H31N3O4S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | tert-butyl N-[1-(4-methylphenyl)sulfonyl-6,6-diphenyl-7H-indazol-3-yl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)n2nc(NC(=O)OC(C)(C)C)c3c2CC(c2ccccc2)(c2ccccc2)C=C3)cc1 |
| InChI | InChI=1S/C31H31N3O4S/c1-22-15-17-25(18-16-22)39(36,37)34-27-21-31(23-11-7-5-8-12-23,24-13-9-6-10-14-24)20-19-26(27)28(33-34)32-29(35)38-30(2,3)4/h5-20H,21H2,1-4H3,(H,32,33,35) |
| InChIKey | XIZSKCNRRXMJPL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |