C17H17NO3 — CID 86594253
benzyl N-(3,4-dihydro-1H-isochromen-6-yl)carbamate (PubChem CID 86594253) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is benzyl N-(3,4-dihydro-1H-isochromen-6-yl)carbamate.
| Compound Name | benzyl N-(3,4-dihydro-1H-isochromen-6-yl)carbamate |
|---|---|
| PubChem CID | 86594253 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | benzyl N-(3,4-dihydro-1H-isochromen-6-yl)carbamate |
| SMILES | O=C(Nc1ccc2c(c1)CCOC2)OCc1ccccc1 |
| InChI | InChI=1S/C17H17NO3/c19-17(21-11-13-4-2-1-3-5-13)18-16-7-6-15-12-20-9-8-14(15)10-16/h1-7,10H,8-9,11-12H2,(H,18,19) |
| InChIKey | HFWQJCUBSWENQU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |