C26H23NO5 — CID 86596241
(2S)-3-[4-[3-[4-(N-hydroxy-C-phenylcarbonimidoyl)phenoxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid (PubChem CID 86596241) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is (2S)-3-[4-[3-[4-(N-hydroxy-C-phenylcarbonimidoyl)phenoxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid.
| Compound Name | (2S)-3-[4-[3-[4-(N-hydroxy-C-phenylcarbonimidoyl)phenoxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 86596241 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2S)-3-[4-[3-[4-(N-hydroxy-C-phenylcarbonimidoyl)phenoxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid |
| SMILES | CO[C@@H](Cc1ccc(C#CCOc2ccc(C(=NO)c3ccccc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H23NO5/c1-31-24(26(28)29)18-20-11-9-19(10-12-20)6-5-17-32-23-15-13-22(14-16-23)25(27-30)21-7-3-2-4-8-21/h2-4,7-16,24,30H,17-18H2,1H3,(H,28,29)/t24-/m0/s1 |
| InChIKey | POQRIROSUQYRIE-DEOSSOPVSA-N |
| XLogP | 3.99 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|