C28H26FNO5 — CID 86596243
(2S)-3-[4-[5-[4-[C-(4-fluorophenyl)-N-hydroxycarbonimidoyl]phenoxy]pent-1-ynyl]phenyl]-2-methoxypropanoic acid (PubChem CID 86596243) has the molecular formula C28H26FNO5 and a molecular weight of 475.52 g/mol. Its IUPAC name is (2S)-3-[4-[5-[4-[C-(4-fluorophenyl)-N-hydroxycarbonimidoyl]phenoxy]pent-1-ynyl]phenyl]-2-methoxypropanoic acid.
| Compound Name | (2S)-3-[4-[5-[4-[C-(4-fluorophenyl)-N-hydroxycarbonimidoyl]phenoxy]pent-1-ynyl]phenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 86596243 |
| Molecular Formula | C28H26FNO5 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (2S)-3-[4-[5-[4-[C-(4-fluorophenyl)-N-hydroxycarbonimidoyl]phenoxy]pent-1-ynyl]phenyl]-2-methoxypropanoic acid |
| SMILES | CO[C@@H](Cc1ccc(C#CCCCOc2ccc(C(=NO)c3ccc(F)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H26FNO5/c1-34-26(28(31)32)19-21-8-6-20(7-9-21)5-3-2-4-18-35-25-16-12-23(13-17-25)27(30-33)22-10-14-24(29)15-11-22/h6-17,26,33H,2,4,18-19H2,1H3,(H,31,32)/t26-/m0/s1 |
| InChIKey | HPDSGOYZTMLRPP-SANMLTNESA-N |
| XLogP | 4.91 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|