C28H28O4 — CID 58822624
(3S)-3-methoxy-4-[4-[5-(4-phenoxyphenoxy)pent-1-ynyl]phenyl]butan-2-one (PubChem CID 58822624) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is (3S)-3-methoxy-4-[4-[5-(4-phenoxyphenoxy)pent-1-ynyl]phenyl]butan-2-one.
| Compound Name | (3S)-3-methoxy-4-[4-[5-(4-phenoxyphenoxy)pent-1-ynyl]phenyl]butan-2-one |
|---|---|
| PubChem CID | 58822624 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (3S)-3-methoxy-4-[4-[5-(4-phenoxyphenoxy)pent-1-ynyl]phenyl]butan-2-one |
| SMILES | CO[C@@H](Cc1ccc(C#CCCCOc2ccc(Oc3ccccc3)cc2)cc1)C(C)=O |
| InChI | InChI=1S/C28H28O4/c1-22(29)28(30-2)21-24-14-12-23(13-15-24)9-5-4-8-20-31-25-16-18-27(19-17-25)32-26-10-6-3-7-11-26/h3,6-7,10-19,28H,4,8,20-21H2,1-2H3/t28-/m0/s1 |
| InChIKey | FFKZEXQNBHHGPA-NDEPHWFRSA-N |
| XLogP | 5.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|