C14H26N4O2S — CID 86596520
tert-butyl (2S)-2-[(dimethylaminomethylidenecarbamothioylamino)methyl]pyrrolidine-1-carboxylate (PubChem CID 86596520) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(dimethylaminomethylidenecarbamothioylamino)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(dimethylaminomethylidenecarbamothioylamino)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86596520 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | tert-butyl (2S)-2-[(dimethylaminomethylidenecarbamothioylamino)methyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C)C=NC(=S)NC[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26N4O2S/c1-14(2,3)20-13(19)18-8-6-7-11(18)9-15-12(21)16-10-17(4)5/h10-11H,6-9H2,1-5H3,(H,15,21)/t11-/m0/s1 |
| InChIKey | OGDWCUMMEVNBGY-NSHDSACASA-N |
| XLogP | 1.85 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|