C13H25N3O2S — CID 97006807
tert-butyl (2R)-2-[(methylcarbamothioylamino)methyl]piperidine-1-carboxylate (PubChem CID 97006807) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(methylcarbamothioylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(methylcarbamothioylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97006807 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | tert-butyl (2R)-2-[(methylcarbamothioylamino)methyl]piperidine-1-carboxylate |
| SMILES | CNC(=S)NC[C@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25N3O2S/c1-13(2,3)18-12(17)16-8-6-5-7-10(16)9-15-11(19)14-4/h10H,5-9H2,1-4H3,(H2,14,15,19)/t10-/m1/s1 |
| InChIKey | MXIOTHXTQZZGJQ-SNVBAGLBSA-N |
| XLogP | 1.87 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|