C13H25NO3 — CID 86597973
ethyl (Z,4R,5R)-3-(methoxyamino)-4,5-dimethyloct-2-enoate (PubChem CID 86597973) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is ethyl (Z,4R,5R)-3-(methoxyamino)-4,5-dimethyloct-2-enoate.
| Compound Name | ethyl (Z,4R,5R)-3-(methoxyamino)-4,5-dimethyloct-2-enoate |
|---|---|
| PubChem CID | 86597973 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | ethyl (Z,4R,5R)-3-(methoxyamino)-4,5-dimethyloct-2-enoate |
| SMILES | CCC[C@@H](C)[C@@H](C)/C(=C/C(=O)OCC)NOC |
| InChI | InChI=1S/C13H25NO3/c1-6-8-10(3)11(4)12(14-16-5)9-13(15)17-7-2/h9-11,14H,6-8H2,1-5H3/b12-9-/t10-,11-/m1/s1 |
| InChIKey | LIJUGLOEBMISCG-ZQKHDVBCSA-N |
| XLogP | 2.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|